About N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal
N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal (PubChem CID 143355704) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal.
Molecular Properties
| Compound Name | N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal |
| PubChem CID | 143355704 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal |
| SMILES | C=CCCN(C)CC.CC/C=C\C(C)C=O |
| InChI | InChI=1S/C7H15N.C7H12O/c1-4-6-7-8(3)5-2;1-3-4-5-7(2)6-8/h4H,1,5-7H2,2-3H3;4-7H,3H2,1-2H3/b;5-4- |
| InChIKey | PZBIMJJUXKPOFU-GUHKXDMSSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal?
The IUPAC name of N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal (CID 143355704) is N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal.
What is the SMILES notation for N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal?
The canonical SMILES for N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal is C=CCCN(C)CC.CC/C=C\C(C)C=O.
What is the InChIKey of N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal?
The InChIKey is PZBIMJJUXKPOFU-GUHKXDMSSA-N. The full InChI is InChI=1S/C7H15N.C7H12O/c1-4-6-7-8(3)5-2;1-3-4-5-7(2)6-8/h4H,1,5-7H2,2-3H3;4-7H,3H2,1-2H3/b;5-4-.
What are the key properties of N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal?
N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal has a molecular weight of 225.38 g/mol, XLogP of 3.30, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylbut-3-en-1-amine;(Z)-2-methylhex-3-enal is sourced from PubChem (CID 143355704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).