C29H49N5O6S — CID 143355852
(2S)-1-[3,3-dimethyl-2-[(2,5,5-trimethyl-4-oxohexan-3-yl)carbamoylamino]butanoyl]-N-[1-ethylsulfanyl-2,3-dioxo-3-(prop-2-enylamino)propyl]pyrrolidine-2-carboxamide (PubChem CID 143355852) has the molecular formula C29H49N5O6S and a molecular weight of 595.81 g/mol. Its IUPAC name is (2S)-1-[3,3-dimethyl-2-[(2,5,5-trimethyl-4-oxohexan-3-yl)carbamoylamino]butanoyl]-N-[1-ethylsulfanyl-2,3-dioxo-3-(prop-2-enylamino)propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[3,3-dimethyl-2-[(2,5,5-trimethyl-4-oxohexan-3-yl)carbamoylamino]butanoyl]-N-[1-ethylsulfanyl-2,3-dioxo-3-(prop-2-enylamino)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143355852 |
| Molecular Formula | C29H49N5O6S |
| Molecular Weight | 595.81 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | (2S)-1-[3,3-dimethyl-2-[(2,5,5-trimethyl-4-oxohexan-3-yl)carbamoylamino]butanoyl]-N-[1-ethylsulfanyl-2,3-dioxo-3-(prop-2-enylamino)propyl]pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(NC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)NC(C(=O)C(C)(C)C)C(C)C)C(C)(C)C)SCC |
| InChI | InChI=1S/C29H49N5O6S/c1-11-15-30-24(38)20(35)25(41-12-2)33-23(37)18-14-13-16-34(18)26(39)21(28(5,6)7)32-27(40)31-19(17(3)4)22(36)29(8,9)10/h11,17-19,21,25H,1,12-16H2,2-10H3,(H,30,38)(H,33,37)(H2,31,32,40)/t18-,19?,21?,25?/m0/s1 |
| InChIKey | VTVZPIZIYZLJGH-MEOBIVBYSA-N |
| XLogP | 2.40 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|