About 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide
4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide (PubChem CID 143356334) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide.
Molecular Properties
| Compound Name | 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide |
| PubChem CID | 143356334 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide |
| SMILES | C=CCNC=O.CC(=O)C(C)CC1CC1 |
| InChI | InChI=1S/C8H14O.C4H7NO/c1-6(7(2)9)5-8-3-4-8;1-2-3-5-4-6/h6,8H,3-5H2,1-2H3;2,4H,1,3H2,(H,5,6) |
| InChIKey | MWMORQZAJQGRFM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide?
The IUPAC name of 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide (CID 143356334) is 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide.
What is the SMILES notation for 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide?
The canonical SMILES for 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide is C=CCNC=O.CC(=O)C(C)CC1CC1.
What is the InChIKey of 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide?
The InChIKey is MWMORQZAJQGRFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.C4H7NO/c1-6(7(2)9)5-8-3-4-8;1-2-3-5-4-6/h6,8H,3-5H2,1-2H3;2,4H,1,3H2,(H,5,6).
What are the key properties of 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide?
4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide has a molecular weight of 211.30 g/mol, XLogP of 1.93, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-3-methylbutan-2-one;N-prop-2-enylformamide is sourced from PubChem (CID 143356334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).