C11H17F3N2O — CID 143356426
6,6,6-trifluoro-3-(methylamino)-2-methylidene-N-prop-2-enylhexanamide (PubChem CID 143356426) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is 6,6,6-trifluoro-3-(methylamino)-2-methylidene-N-prop-2-enylhexanamide.
| Compound Name | 6,6,6-trifluoro-3-(methylamino)-2-methylidene-N-prop-2-enylhexanamide |
|---|---|
| PubChem CID | 143356426 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 6,6,6-trifluoro-3-(methylamino)-2-methylidene-N-prop-2-enylhexanamide |
| SMILES | C=CCNC(=O)C(=C)C(CCC(F)(F)F)NC |
| InChI | InChI=1S/C11H17F3N2O/c1-4-7-16-10(17)8(2)9(15-3)5-6-11(12,13)14/h4,9,15H,1-2,5-7H2,3H3,(H,16,17) |
| InChIKey | ZVJHEDORKJCNEF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|