About ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide
ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide (PubChem CID 143356504) has the molecular formula C20H42N2O
and a molecular weight of 326.57 g/mol. Its IUPAC name is ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide.
Molecular Properties
| Compound Name | ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide |
| PubChem CID | 143356504 |
| Molecular Formula | C20H42N2O |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.33 |
| IUPAC Name | ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide |
| SMILES | C=CCC(C)(C)CC(=O)N(C)CCNC(=C)C.CC.CC(C)C |
| InChI | InChI=1S/C14H26N2O.C4H10.C2H6/c1-7-8-14(4,5)11-13(17)16(6)10-9-15-12(2)3;1-4(2)3;1-2/h7,15H,1-2,8-11H2,3-6H3;4H,1-3H3;1-2H3 |
| InChIKey | KTOLAMVWKWAQRI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide?
The IUPAC name of ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide (CID 143356504) is ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide.
What is the SMILES notation for ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide?
The canonical SMILES for ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide is C=CCC(C)(C)CC(=O)N(C)CCNC(=C)C.CC.CC(C)C.
What is the InChIKey of ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide?
The InChIKey is KTOLAMVWKWAQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O.C4H10.C2H6/c1-7-8-14(4,5)11-13(17)16(6)10-9-15-12(2)3;1-4(2)3;1-2/h7,15H,1-2,8-11H2,3-6H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide?
ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide has a molecular weight of 326.57 g/mol, XLogP of 5.25, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;N,3,3-trimethyl-N-[2-(prop-1-en-2-ylamino)ethyl]hex-5-enamide is sourced from PubChem (CID 143356504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).