About (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide
(8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide (PubChem CID 143357404) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide.
Analyze (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide?
The IUPAC name of (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide (CID 143357404) is (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide.
What is the SMILES notation for (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide?
The canonical SMILES for (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide is O=S1(=O)CNCC2C=CC=C[C@H]21.
What is the InChIKey of (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide?
The InChIKey is HREYWQGLXVJYBS-BRFYHDHCSA-N. The full InChI is InChI=1S/C8H11NO2S/c10-12(11)6-9-5-7-3-1-2-4-8(7)12/h1-4,7-9H,5-6H2/t7?,8-/m1/s1.
What are the key properties of (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide?
(8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide has a molecular weight of 185.25 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8aR)-3,4,4a,8a-tetrahydro-2H-1λ6,3-benzothiazine 1,1-dioxide is sourced from PubChem (CID 143357404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).