C28H46F3N5O7S — CID 143357758
propan-2-yl 2-[[1-[2-[[3-(ethylamino)-2,3-dioxo-1-(2,2,2-trifluoroethylsulfanyl)propyl]carbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]-3,3-dimethylbutanoate (PubChem CID 143357758) has the molecular formula C28H46F3N5O7S and a molecular weight of 653.77 g/mol. Its IUPAC name is propan-2-yl 2-[[1-[2-[[3-(ethylamino)-2,3-dioxo-1-(2,2,2-trifluoroethylsulfanyl)propyl]carbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]-3,3-dimethylbutanoate.
| Compound Name | propan-2-yl 2-[[1-[2-[[3-(ethylamino)-2,3-dioxo-1-(2,2,2-trifluoroethylsulfanyl)propyl]carbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 143357758 |
| Molecular Formula | C28H46F3N5O7S |
| Molecular Weight | 653.77 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | propan-2-yl 2-[[1-[2-[[3-(ethylamino)-2,3-dioxo-1-(2,2,2-trifluoroethylsulfanyl)propyl]carbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoylamino]-3,3-dimethylbutanoate |
| SMILES | CCNC(=O)C(=O)C(NC(=O)C1CCCN1C(=O)C(NC(=O)NC(C(=O)OC(C)C)C(C)(C)C)C(C)(C)C)SCC(F)(F)F |
| InChI | InChI=1S/C28H46F3N5O7S/c1-10-32-21(39)17(37)22(44-14-28(29,30)31)35-20(38)16-12-11-13-36(16)23(40)18(26(4,5)6)33-25(42)34-19(27(7,8)9)24(41)43-15(2)3/h15-16,18-19,22H,10-14H2,1-9H3,(H,32,39)(H,35,38)(H2,33,34,42) |
| InChIKey | WHIPOJSIWLMGFO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|