About 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine
8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine (PubChem CID 143358033) has the molecular formula C17H31N
and a molecular weight of 249.44 g/mol. Its IUPAC name is 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine.
Molecular Properties
| Compound Name | 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine |
| PubChem CID | 143358033 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine |
| SMILES | C=C(CCC1CC1)CCC(NC(=C)C)C(C)(C)C |
| InChI | InChI=1S/C17H31N/c1-13(2)18-16(17(4,5)6)12-8-14(3)7-9-15-10-11-15/h15-16,18H,1,3,7-12H2,2,4-6H3 |
| InChIKey | SIABCQQVWIWQHR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine?
The IUPAC name of 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine (CID 143358033) is 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine.
What is the SMILES notation for 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine?
The canonical SMILES for 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine is C=C(CCC1CC1)CCC(NC(=C)C)C(C)(C)C.
What is the InChIKey of 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine?
The InChIKey is SIABCQQVWIWQHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31N/c1-13(2)18-16(17(4,5)6)12-8-14(3)7-9-15-10-11-15/h15-16,18H,1,3,7-12H2,2,4-6H3.
What are the key properties of 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine?
8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine has a molecular weight of 249.44 g/mol, XLogP of 5.05, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclopropyl-2,2-dimethyl-6-methylidene-N-prop-1-en-2-yloctan-3-amine is sourced from PubChem (CID 143358033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).