C24H42N6O5 — CID 143358614
N-[3-amino-1-(cyclobutylamino)-2,3-dioxopropyl]-1-[2-(2,2-dimethylpropylcarbamoylamino)-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 143358614) has the molecular formula C24H42N6O5 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[3-amino-1-(cyclobutylamino)-2,3-dioxopropyl]-1-[2-(2,2-dimethylpropylcarbamoylamino)-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[3-amino-1-(cyclobutylamino)-2,3-dioxopropyl]-1-[2-(2,2-dimethylpropylcarbamoylamino)-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143358614 |
| Molecular Formula | C24H42N6O5 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | N-[3-amino-1-(cyclobutylamino)-2,3-dioxopropyl]-1-[2-(2,2-dimethylpropylcarbamoylamino)-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)CNC(=O)NC(C(=O)N1CCCC1C(=O)NC(NC1CCC1)C(=O)C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C24H42N6O5/c1-23(2,3)13-26-22(35)28-17(24(4,5)6)21(34)30-12-8-11-15(30)20(33)29-19(16(31)18(25)32)27-14-9-7-10-14/h14-15,17,19,27H,7-13H2,1-6H3,(H2,25,32)(H,29,33)(H2,26,28,35) |
| InChIKey | XKTNHDGFPMABGM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|