C18H32N3O4P — CID 143359448
methyl (2S,3R)-1-[(2S)-3,3-dimethyl-2-(propylphosphanylcarbamoylamino)butanoyl]-3-ethenylpyrrolidine-2-carboxylate (PubChem CID 143359448) has the molecular formula C18H32N3O4P and a molecular weight of 385.45 g/mol. Its IUPAC name is methyl (2S,3R)-1-[(2S)-3,3-dimethyl-2-(propylphosphanylcarbamoylamino)butanoyl]-3-ethenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3R)-1-[(2S)-3,3-dimethyl-2-(propylphosphanylcarbamoylamino)butanoyl]-3-ethenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 143359448 |
| Molecular Formula | C18H32N3O4P |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | methyl (2S,3R)-1-[(2S)-3,3-dimethyl-2-(propylphosphanylcarbamoylamino)butanoyl]-3-ethenylpyrrolidine-2-carboxylate |
| SMILES | C=C[C@H]1CCN(C(=O)[C@@H](NC(=O)NPCCC)C(C)(C)C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C18H32N3O4P/c1-7-11-26-20-17(24)19-14(18(3,4)5)15(22)21-10-9-12(8-2)13(21)16(23)25-6/h8,12-14,26H,2,7,9-11H2,1,3-6H3,(H2,19,20,24)/t12-,13-,14+/m0/s1 |
| InChIKey | NPACCBDUQTYZLB-MELADBBJSA-N |
| XLogP | 2.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|