C26H37N7O — CID 143359561
ethane;5-[5-(ethylaminomethyl)-3-pyridinyl]-3-[4-[(E)-5-methoxypent-3-enyl]-5-methyl-1H-imidazole-2-carboximidoyl]pyridin-2-amine (PubChem CID 143359561) has the molecular formula C26H37N7O and a molecular weight of 463.63 g/mol. Its IUPAC name is ethane;5-[5-(ethylaminomethyl)-3-pyridinyl]-3-[4-[(E)-5-methoxypent-3-enyl]-5-methyl-1H-imidazole-2-carboximidoyl]pyridin-2-amine.
| Compound Name | ethane;5-[5-(ethylaminomethyl)-3-pyridinyl]-3-[4-[(E)-5-methoxypent-3-enyl]-5-methyl-1H-imidazole-2-carboximidoyl]pyridin-2-amine |
|---|---|
| PubChem CID | 143359561 |
| Molecular Formula | C26H37N7O |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | ethane;5-[5-(ethylaminomethyl)-3-pyridinyl]-3-[4-[(E)-5-methoxypent-3-enyl]-5-methyl-1H-imidazole-2-carboximidoyl]pyridin-2-amine |
| SMILES | CC.[H]/N=C(\c1nc(CC/C=C/COC)c(C)[nH]1)c1cc(-c2cncc(CNCC)c2)cnc1N |
| InChI | InChI=1S/C24H31N7O.C2H6/c1-4-27-12-17-10-18(14-28-13-17)19-11-20(23(26)29-15-19)22(25)24-30-16(2)21(31-24)8-6-5-7-9-32-3;1-2/h5,7,10-11,13-15,25,27H,4,6,8-9,12H2,1-3H3,(H2,26,29)(H,30,31);1-2H3/b7-5+,25-22-; |
| InChIKey | XUBKKMUUVVGXCT-IJCMCPTGSA-N |
| XLogP | 4.44 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|