C32H45N5O8S — CID 143359693
N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-1-[2-[[1-(furan-2-ylmethylsulfonylmethyl)cyclohexyl]carbamoylamino]acetyl]-3,4-dimethylpyrrolidine-2-carboxamide (PubChem CID 143359693) has the molecular formula C32H45N5O8S and a molecular weight of 659.81 g/mol. Its IUPAC name is N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-1-[2-[[1-(furan-2-ylmethylsulfonylmethyl)cyclohexyl]carbamoylamino]acetyl]-3,4-dimethylpyrrolidine-2-carboxamide.
| Compound Name | N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-1-[2-[[1-(furan-2-ylmethylsulfonylmethyl)cyclohexyl]carbamoylamino]acetyl]-3,4-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143359693 |
| Molecular Formula | C32H45N5O8S |
| Molecular Weight | 659.81 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-1-[2-[[1-(furan-2-ylmethylsulfonylmethyl)cyclohexyl]carbamoylamino]acetyl]-3,4-dimethylpyrrolidine-2-carboxamide |
| SMILES | C#CCCC(NC(=O)C1C(C)C(C)CN1C(=O)CNC(=O)NC1(CS(=O)(=O)Cc2ccco2)CCCCC1)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C32H45N5O8S/c1-5-7-13-25(28(39)30(41)33-16-6-2)35-29(40)27-23(4)22(3)19-37(27)26(38)18-34-31(42)36-32(14-9-8-10-15-32)21-46(43,44)20-24-12-11-17-45-24/h1,6,11-12,17,22-23,25,27H,2,7-10,13-16,18-21H2,3-4H3,(H,33,41)(H,35,40)(H2,34,36,42) |
| InChIKey | PPTCSZNDVKHIOE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 183.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.81 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|