C33H61N5 — CID 143360040
2-N-[1-[[2-[2-[1-[(1-cyclobutyl-3-methylbut-3-en-2-yl)amino]ethenyl]-4-methylpyrrolidin-1-yl]-4,4-dimethylpent-1-en-3-yl]amino]ethenyl]-1-N,1-N,3,3-tetramethylbutane-1,2-diamine (PubChem CID 143360040) has the molecular formula C33H61N5 and a molecular weight of 527.89 g/mol. Its IUPAC name is 2-N-[1-[[2-[2-[1-[(1-cyclobutyl-3-methylbut-3-en-2-yl)amino]ethenyl]-4-methylpyrrolidin-1-yl]-4,4-dimethylpent-1-en-3-yl]amino]ethenyl]-1-N,1-N,3,3-tetramethylbutane-1,2-diamine.
| Compound Name | 2-N-[1-[[2-[2-[1-[(1-cyclobutyl-3-methylbut-3-en-2-yl)amino]ethenyl]-4-methylpyrrolidin-1-yl]-4,4-dimethylpent-1-en-3-yl]amino]ethenyl]-1-N,1-N,3,3-tetramethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 143360040 |
| Molecular Formula | C33H61N5 |
| Molecular Weight | 527.89 g/mol |
| Exact Mass | 527.49 |
| IUPAC Name | 2-N-[1-[[2-[2-[1-[(1-cyclobutyl-3-methylbut-3-en-2-yl)amino]ethenyl]-4-methylpyrrolidin-1-yl]-4,4-dimethylpent-1-en-3-yl]amino]ethenyl]-1-N,1-N,3,3-tetramethylbutane-1,2-diamine |
| SMILES | C=C(NC(CN(C)C)C(C)(C)C)NC(C(=C)N1CC(C)CC1C(=C)NC(CC1CCC1)C(=C)C)C(C)(C)C |
| InChI | InChI=1S/C33H61N5/c1-22(2)28(19-27-16-15-17-27)34-24(4)29-18-23(3)20-38(29)25(5)31(33(10,11)12)36-26(6)35-30(21-37(13)14)32(7,8)9/h23,27-31,34-36H,1,4-6,15-21H2,2-3,7-14H3 |
| InChIKey | GSWYFPGJOBKYSK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.89 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|