C34H49N5O6 — CID 143360363
(1S,5R)-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-3-[3,3-dimethyl-2-[[1-(phenylmethoxymethyl)cyclohexyl]carbamoylamino]butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 143360363) has the molecular formula C34H49N5O6 and a molecular weight of 623.80 g/mol. Its IUPAC name is (1S,5R)-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-3-[3,3-dimethyl-2-[[1-(phenylmethoxymethyl)cyclohexyl]carbamoylamino]butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1S,5R)-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-3-[3,3-dimethyl-2-[[1-(phenylmethoxymethyl)cyclohexyl]carbamoylamino]butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 143360363 |
| Molecular Formula | C34H49N5O6 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.37 |
| IUPAC Name | (1S,5R)-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-3-[3,3-dimethyl-2-[[1-(phenylmethoxymethyl)cyclohexyl]carbamoylamino]butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)NC1(COCc2ccccc2)CCCCC1)C(=O)N1C[C@@H]2C[C@@H]2C1C(=O)NC(CC1CC1)C(=O)C(N)=O |
| InChI | InChI=1S/C34H49N5O6/c1-33(2,3)28(37-32(44)38-34(14-8-5-9-15-34)20-45-19-22-10-6-4-7-11-22)31(43)39-18-23-17-24(23)26(39)30(42)36-25(16-21-12-13-21)27(40)29(35)41/h4,6-7,10-11,21,23-26,28H,5,8-9,12-20H2,1-3H3,(H2,35,41)(H,36,42)(H2,37,38,44)/t23-,24-,25?,26?,28?/m0/s1 |
| InChIKey | RMVWIKFFSVCMND-PQAXFTNFSA-N |
| XLogP | 2.81 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|