About ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal
ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal (PubChem CID 143360432) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal.
Molecular Properties
| Compound Name | ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal |
| PubChem CID | 143360432 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal |
| SMILES | CC.CCN(C)CC/C=C\C=C/CC=O |
| InChI | InChI=1S/C11H19NO.C2H6/c1-3-12(2)10-8-6-4-5-7-9-11-13;1-2/h4-7,11H,3,8-10H2,1-2H3;1-2H3/b6-4-,7-5-; |
| InChIKey | LLGYUDYSMXDSCR-ISOJEIHBSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal?
The IUPAC name of ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal (CID 143360432) is ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal.
What is the SMILES notation for ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal?
The canonical SMILES for ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal is CC.CCN(C)CC/C=C\C=C/CC=O.
What is the InChIKey of ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal?
The InChIKey is LLGYUDYSMXDSCR-ISOJEIHBSA-N. The full InChI is InChI=1S/C11H19NO.C2H6/c1-3-12(2)10-8-6-4-5-7-9-11-13;1-2/h4-7,11H,3,8-10H2,1-2H3;1-2H3/b6-4-,7-5-;.
What are the key properties of ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal?
ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal has a molecular weight of 211.35 g/mol, XLogP of 3.06, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z,5Z)-8-[ethyl(methyl)amino]octa-3,5-dienal is sourced from PubChem (CID 143360432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).