C40H73N5O4 — CID 143360734
3-[1-[(4S)-4-tert-butyl-1-[2-(1-methylcyclohexyl)-2-(2-methylhexan-3-ylcarbamoylamino)acetyl]pyrrolidin-2-yl]ethenylamino]-2-oxo-N-prop-2-enylheptanamide;propane (PubChem CID 143360734) has the molecular formula C40H73N5O4 and a molecular weight of 688.05 g/mol. Its IUPAC name is 3-[1-[(4S)-4-tert-butyl-1-[2-(1-methylcyclohexyl)-2-(2-methylhexan-3-ylcarbamoylamino)acetyl]pyrrolidin-2-yl]ethenylamino]-2-oxo-N-prop-2-enylheptanamide;propane.
| Compound Name | 3-[1-[(4S)-4-tert-butyl-1-[2-(1-methylcyclohexyl)-2-(2-methylhexan-3-ylcarbamoylamino)acetyl]pyrrolidin-2-yl]ethenylamino]-2-oxo-N-prop-2-enylheptanamide;propane |
|---|---|
| PubChem CID | 143360734 |
| Molecular Formula | C40H73N5O4 |
| Molecular Weight | 688.05 g/mol |
| Exact Mass | 687.57 |
| IUPAC Name | 3-[1-[(4S)-4-tert-butyl-1-[2-(1-methylcyclohexyl)-2-(2-methylhexan-3-ylcarbamoylamino)acetyl]pyrrolidin-2-yl]ethenylamino]-2-oxo-N-prop-2-enylheptanamide;propane |
| SMILES | C=CCNC(=O)C(=O)C(CCCC)NC(=C)C1C[C@@H](C(C)(C)C)CN1C(=O)C(NC(=O)NC(CCC)C(C)C)C1(C)CCCCC1.CCC |
| InChI | InChI=1S/C37H65N5O4.C3H8/c1-11-14-19-29(31(43)33(44)38-22-13-3)39-26(6)30-23-27(36(7,8)9)24-42(30)34(45)32(37(10)20-16-15-17-21-37)41-35(46)40-28(18-12-2)25(4)5;1-3-2/h13,25,27-30,32,39H,3,6,11-12,14-24H2,1-2,4-5,7-10H3,(H,38,44)(H2,40,41,46);3H2,1-2H3/t27-,28?,29?,30?,32?;/m1./s1 |
| InChIKey | JURHLMGXECIUKJ-LZOISANYSA-N |
| XLogP | 7.66 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.05 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|