About 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane
4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane (PubChem CID 143361158) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane.
Molecular Properties
| Compound Name | 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane |
| PubChem CID | 143361158 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane |
| SMILES | C.C=CC1CN(C)C(C)C1(C)/C=C\C |
| InChI | InChI=1S/C12H21N.CH4/c1-6-8-12(4)10(3)13(5)9-11(12)7-2;/h6-8,10-11H,2,9H2,1,3-5H3;1H4/b8-6-; |
| InChIKey | SVMIQPZPDJEGMT-PHZXCRFESA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane?
The IUPAC name of 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane (CID 143361158) is 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane.
What is the SMILES notation for 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane?
The canonical SMILES for 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane is C.C=CC1CN(C)C(C)C1(C)/C=C\C.
What is the InChIKey of 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane?
The InChIKey is SVMIQPZPDJEGMT-PHZXCRFESA-N. The full InChI is InChI=1S/C12H21N.CH4/c1-6-8-12(4)10(3)13(5)9-11(12)7-2;/h6-8,10-11H,2,9H2,1,3-5H3;1H4/b8-6-;.
What are the key properties of 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane?
4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane has a molecular weight of 195.35 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-1,2,3-trimethyl-3-[(Z)-prop-1-enyl]pyrrolidine;methane is sourced from PubChem (CID 143361158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).