About (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol
(Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol (PubChem CID 14336215) has the molecular formula C13H28O2Si
and a molecular weight of 244.45 g/mol. Its IUPAC name is (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol.
Molecular Properties
| Compound Name | (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol |
| PubChem CID | 14336215 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol |
| SMILES | C/C(=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C13H28O2Si/c1-11(9-14)8-12(2)10-15-16(6,7)13(3,4)5/h8,12,14H,9-10H2,1-7H3/b11-8-/t12-/m1/s1 |
| InChIKey | JQOONQWRPHRAML-NXIHDVOMSA-N |
| XLogP | 3.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol?
The IUPAC name of (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol (CID 14336215) is (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol.
What is the SMILES notation for (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol?
The canonical SMILES for (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol is C/C(=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C)CO.
What is the InChIKey of (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol?
The InChIKey is JQOONQWRPHRAML-NXIHDVOMSA-N. The full InChI is InChI=1S/C13H28O2Si/c1-11(9-14)8-12(2)10-15-16(6,7)13(3,4)5/h8,12,14H,9-10H2,1-7H3/b11-8-/t12-/m1/s1.
What are the key properties of (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol?
(Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol has a molecular weight of 244.45 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-en-1-ol is sourced from PubChem (CID 14336215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).