C29H41N5O8 — CID 143362436
[(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)amino] (2S)-1-[3,3-dimethyl-2-[(2-oxo-2-phenylmethoxyethyl)carbamoylamino]butanoyl]pyrrolidine-2-carboxylate (PubChem CID 143362436) has the molecular formula C29H41N5O8 and a molecular weight of 587.67 g/mol. Its IUPAC name is [(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)amino] (2S)-1-[3,3-dimethyl-2-[(2-oxo-2-phenylmethoxyethyl)carbamoylamino]butanoyl]pyrrolidine-2-carboxylate.
| Compound Name | [(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)amino] (2S)-1-[3,3-dimethyl-2-[(2-oxo-2-phenylmethoxyethyl)carbamoylamino]butanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 143362436 |
| Molecular Formula | C29H41N5O8 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | [(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)amino] (2S)-1-[3,3-dimethyl-2-[(2-oxo-2-phenylmethoxyethyl)carbamoylamino]butanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)C(NC(=O)NCC(=O)OCc1ccccc1)C(=O)N1CCC[C@H]1C(=O)ONC(CC1CCC1)C(=O)C(N)=O |
| InChI | InChI=1S/C29H41N5O8/c1-29(2,3)24(32-28(40)31-16-22(35)41-17-19-9-5-4-6-10-19)26(38)34-14-8-13-21(34)27(39)42-33-20(23(36)25(30)37)15-18-11-7-12-18/h4-6,9-10,18,20-21,24,33H,7-8,11-17H2,1-3H3,(H2,30,37)(H2,31,32,40)/t20?,21-,24?/m0/s1 |
| InChIKey | RJJXPHIVEKUOTA-DQBMGFJSSA-N |
| XLogP | 1.10 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|