C44H84N4 — CID 143363444
3-(2,4-dimethylhexan-3-yl)-7,7-dimethyl-5-methylidene-2-N-[3-methylidene-2-(propylamino)hept-1-en-4-yl]-6-N-[1-(2,2,6-trimethylhept-6-en-3-ylamino)ethenyl]oct-1-ene-2,6-diamine;ethane (PubChem CID 143363444) has the molecular formula C44H84N4 and a molecular weight of 669.18 g/mol. Its IUPAC name is 3-(2,4-dimethylhexan-3-yl)-7,7-dimethyl-5-methylidene-2-N-[3-methylidene-2-(propylamino)hept-1-en-4-yl]-6-N-[1-(2,2,6-trimethylhept-6-en-3-ylamino)ethenyl]oct-1-ene-2,6-diamine;ethane.
| Compound Name | 3-(2,4-dimethylhexan-3-yl)-7,7-dimethyl-5-methylidene-2-N-[3-methylidene-2-(propylamino)hept-1-en-4-yl]-6-N-[1-(2,2,6-trimethylhept-6-en-3-ylamino)ethenyl]oct-1-ene-2,6-diamine;ethane |
|---|---|
| PubChem CID | 143363444 |
| Molecular Formula | C44H84N4 |
| Molecular Weight | 669.18 g/mol |
| Exact Mass | 668.67 |
| IUPAC Name | 3-(2,4-dimethylhexan-3-yl)-7,7-dimethyl-5-methylidene-2-N-[3-methylidene-2-(propylamino)hept-1-en-4-yl]-6-N-[1-(2,2,6-trimethylhept-6-en-3-ylamino)ethenyl]oct-1-ene-2,6-diamine;ethane |
| SMILES | C=C(C)CCC(NC(=C)NC(C(=C)CC(C(=C)NC(CCC)C(=C)C(=C)NCCC)C(C(C)C)C(C)CC)C(C)(C)C)C(C)(C)C.CC |
| InChI | InChI=1S/C42H78N4.C2H6/c1-20-23-37(32(10)33(11)43-26-21-2)44-34(12)36(39(29(6)7)30(8)22-3)27-31(9)40(42(17,18)19)46-35(13)45-38(41(14,15)16)25-24-28(4)5;1-2/h29-30,36-40,43-46H,4,9-13,20-27H2,1-3,5-8,14-19H3;1-2H3 |
| InChIKey | JEUMQCYFCSWCEU-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.18 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|