About 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine
3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine (PubChem CID 143364157) has the molecular formula C24H19N3
and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine |
| PubChem CID | 143364157 |
| Molecular Formula | C24H19N3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine |
| SMILES | Cc1ccc(-c2cnc3[nH]c4ccc(N)cc4c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19N3/c1-15-7-9-16(10-8-15)20-14-26-24-23(22(20)17-5-3-2-4-6-17)19-13-18(25)11-12-21(19)27-24/h2-14H,25H2,1H3,(H,26,27) |
| InChIKey | KQEZHWHYFUHHKW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine?
The IUPAC name of 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine (CID 143364157) is 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine.
What is the SMILES notation for 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine?
The canonical SMILES for 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine is Cc1ccc(-c2cnc3[nH]c4ccc(N)cc4c3c2-c2ccccc2)cc1.
What is the InChIKey of 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine?
The InChIKey is KQEZHWHYFUHHKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N3/c1-15-7-9-16(10-8-15)20-14-26-24-23(22(20)17-5-3-2-4-6-17)19-13-18(25)11-12-21(19)27-24/h2-14H,25H2,1H3,(H,26,27).
What are the key properties of 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine?
3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine has a molecular weight of 349.44 g/mol, XLogP of 5.94, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-amine is sourced from PubChem (CID 143364157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).