About 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole
3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole (PubChem CID 143364253) has the molecular formula C26H16FN3OS2
and a molecular weight of 469.57 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole |
| PubChem CID | 143364253 |
| Molecular Formula | C26H16FN3OS2 |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole |
| SMILES | Fc1ccc(-c2cnc3[nH]c4ccc(OSc5cccs5)cc4c3c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C26H16FN3OS2/c27-18-5-3-16(4-6-18)21-15-29-26-25(24(21)17-9-11-28-12-10-17)20-14-19(7-8-22(20)30-26)31-33-23-2-1-13-32-23/h1-15H,(H,29,30) |
| InChIKey | NLYSYIXFHQNXMN-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole?
The IUPAC name of 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole (CID 143364253) is 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole?
The canonical SMILES for 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole is Fc1ccc(-c2cnc3[nH]c4ccc(OSc5cccs5)cc4c3c2-c2ccncc2)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole?
The InChIKey is NLYSYIXFHQNXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16FN3OS2/c27-18-5-3-16(4-6-18)21-15-29-26-25(24(21)17-9-11-28-12-10-17)20-14-19(7-8-22(20)30-26)31-33-23-2-1-13-32-23/h1-15H,(H,29,30).
What are the key properties of 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole?
3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole has a molecular weight of 469.57 g/mol, XLogP of 7.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-4-pyridin-4-yl-6-thiophen-2-ylsulfanyloxy-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 143364253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).