C40H38N4O3S2 — CID 143364258
N-[4-[6-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfinylmethyl]-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-pyridin-2-yloxypropane-1-sulfinamide (PubChem CID 143364258) has the molecular formula C40H38N4O3S2 and a molecular weight of 686.90 g/mol. Its IUPAC name is N-[4-[6-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfinylmethyl]-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-pyridin-2-yloxypropane-1-sulfinamide.
| Compound Name | N-[4-[6-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfinylmethyl]-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-pyridin-2-yloxypropane-1-sulfinamide |
|---|---|
| PubChem CID | 143364258 |
| Molecular Formula | C40H38N4O3S2 |
| Molecular Weight | 686.90 g/mol |
| Exact Mass | 686.24 |
| IUPAC Name | N-[4-[6-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfinylmethyl]-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]phenyl]-N-methyl-3-pyridin-2-yloxypropane-1-sulfinamide |
| SMILES | C=C/C(=C\C=C/C)S(=O)Cc1ccc2[nH]c3ncc(-c4ccc(N(C)S(=O)CCCOc5ccccn5)cc4)c(-c4ccccc4)c3c2c1 |
| InChI | InChI=1S/C40H38N4O3S2/c1-4-6-15-33(5-2)48(45)28-29-17-22-36-34(26-29)39-38(31-13-8-7-9-14-31)35(27-42-40(39)43-36)30-18-20-32(21-19-30)44(3)49(46)25-12-24-47-37-16-10-11-23-41-37/h4-11,13-23,26-27H,2,12,24-25,28H2,1,3H3,(H,42,43)/b6-4-,33-15+ |
| InChIKey | JGMFYTPFSFPGFY-UFCRHIRGSA-N |
| XLogP | 8.91 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.90 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|