C34H26FN5O3S — CID 143364272
N-(2-cyanoethyl)-4-[6-[(3-fluorophenyl)sulfonyl-methylamino]-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzamide (PubChem CID 143364272) has the molecular formula C34H26FN5O3S and a molecular weight of 603.68 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-[6-[(3-fluorophenyl)sulfonyl-methylamino]-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzamide.
| Compound Name | N-(2-cyanoethyl)-4-[6-[(3-fluorophenyl)sulfonyl-methylamino]-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzamide |
|---|---|
| PubChem CID | 143364272 |
| Molecular Formula | C34H26FN5O3S |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | N-(2-cyanoethyl)-4-[6-[(3-fluorophenyl)sulfonyl-methylamino]-4-phenyl-9H-pyrido[2,3-b]indol-3-yl]benzamide |
| SMILES | CN(c1ccc2[nH]c3ncc(-c4ccc(C(=O)NCCC#N)cc4)c(-c4ccccc4)c3c2c1)S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C34H26FN5O3S/c1-40(44(42,43)27-10-5-9-25(35)19-27)26-15-16-30-28(20-26)32-31(23-7-3-2-4-8-23)29(21-38-33(32)39-30)22-11-13-24(14-12-22)34(41)37-18-6-17-36/h2-5,7-16,19-21H,6,18H2,1H3,(H,37,41)(H,38,39) |
| InChIKey | NHKKEPOJIWNKOT-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|