About [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate
[3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate (PubChem CID 143364296) has the molecular formula C27H17FN2O2S2
and a molecular weight of 484.58 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate.
Molecular Properties
| Compound Name | [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate |
| PubChem CID | 143364296 |
| Molecular Formula | C27H17FN2O2S2 |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate |
| SMILES | O=S(Oc1ccc2[nH]c3ncc(-c4ccc(F)cc4)c(-c4ccccc4)c3c2c1)c1cccs1 |
| InChI | InChI=1S/C27H17FN2O2S2/c28-19-10-8-17(9-11-19)22-16-29-27-26(25(22)18-5-2-1-3-6-18)21-15-20(12-13-23(21)30-27)32-34(31)24-7-4-14-33-24/h1-16H,(H,29,30) |
| InChIKey | OZLUYYLLVTVPRL-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate?
The IUPAC name of [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate (CID 143364296) is [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate.
What is the SMILES notation for [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate?
The canonical SMILES for [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate is O=S(Oc1ccc2[nH]c3ncc(-c4ccc(F)cc4)c(-c4ccccc4)c3c2c1)c1cccs1.
What is the InChIKey of [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate?
The InChIKey is OZLUYYLLVTVPRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H17FN2O2S2/c28-19-10-8-17(9-11-19)22-16-29-27-26(25(22)18-5-2-1-3-6-18)21-15-20(12-13-23(21)30-27)32-34(31)24-7-4-14-33-24/h1-16H,(H,29,30).
What are the key properties of [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate?
[3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate has a molecular weight of 484.58 g/mol, XLogP of 7.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-fluorophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] thiophene-2-sulfinate is sourced from PubChem (CID 143364296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).