About (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane
(3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane (PubChem CID 143364874) has the molecular formula C23H43NS
and a molecular weight of 365.67 g/mol. Its IUPAC name is (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane.
Molecular Properties
| Compound Name | (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane |
| PubChem CID | 143364874 |
| Molecular Formula | C23H43NS |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane |
| SMILES | C=C(NCC)/C(CCCC)=C(/C)SC1CCCCC1.CC1CCCC1 |
| InChI | InChI=1S/C17H31NS.C6H12/c1-5-7-13-17(14(3)18-6-2)15(4)19-16-11-9-8-10-12-16;1-6-4-2-3-5-6/h16,18H,3,5-13H2,1-2,4H3;6H,2-5H2,1H3/b17-15-; |
| InChIKey | XAUSQXYALZRYCH-NYDCQJDFSA-N |
| XLogP | 7.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane?
The IUPAC name of (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane (CID 143364874) is (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane.
What is the SMILES notation for (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane?
The canonical SMILES for (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane is C=C(NCC)/C(CCCC)=C(/C)SC1CCCCC1.CC1CCCC1.
What is the InChIKey of (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane?
The InChIKey is XAUSQXYALZRYCH-NYDCQJDFSA-N. The full InChI is InChI=1S/C17H31NS.C6H12/c1-5-7-13-17(14(3)18-6-2)15(4)19-16-11-9-8-10-12-16;1-6-4-2-3-5-6/h16,18H,3,5-13H2,1-2,4H3;6H,2-5H2,1H3/b17-15-;.
What are the key properties of (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane?
(3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane has a molecular weight of 365.67 g/mol, XLogP of 7.84, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(1-cyclohexylsulfanylethylidene)-N-ethylhept-1-en-2-amine;methylcyclopentane is sourced from PubChem (CID 143364874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).