C20H32O2 — CID 14336533
(1S,3S,4Z,6E,10E,13E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-4,6,10,13-tetraene-1,3-diol (PubChem CID 14336533) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,3S,4Z,6E,10E,13E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-4,6,10,13-tetraene-1,3-diol.
| Compound Name | (1S,3S,4Z,6E,10E,13E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-4,6,10,13-tetraene-1,3-diol |
|---|---|
| PubChem CID | 14336533 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,3S,4Z,6E,10E,13E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-4,6,10,13-tetraene-1,3-diol |
| SMILES | C/C1=C\CC/C(C)=C/C=C(/C(C)C)[C@@H](O)C[C@](C)(O)/C=C/C1 |
| InChI | InChI=1S/C20H32O2/c1-15(2)18-12-11-17(4)9-6-8-16(3)10-7-13-20(5,22)14-19(18)21/h7-8,11-13,15,19,21-22H,6,9-10,14H2,1-5H3/b13-7+,16-8+,17-11+,18-12-/t19-,20+/m0/s1 |
| InChIKey | CARDWPJQSUSFMN-BJOCBAGDSA-N |
| XLogP | 4.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|