C20H30 — CID 14336537
(1E,3Z,6E,10E)-6,10-dimethyl-14-methylidene-3-propan-2-ylcyclotetradeca-1,3,6,10-tetraene (PubChem CID 14336537) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is (1E,3Z,6E,10E)-6,10-dimethyl-14-methylidene-3-propan-2-ylcyclotetradeca-1,3,6,10-tetraene.
| Compound Name | (1E,3Z,6E,10E)-6,10-dimethyl-14-methylidene-3-propan-2-ylcyclotetradeca-1,3,6,10-tetraene |
|---|---|
| PubChem CID | 14336537 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (1E,3Z,6E,10E)-6,10-dimethyl-14-methylidene-3-propan-2-ylcyclotetradeca-1,3,6,10-tetraene |
| SMILES | C=C1/C=C/C(C(C)C)=C\C/C(C)=C/CC/C(C)=C\CC1 |
| InChI | InChI=1S/C20H30/c1-16(2)20-14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h8,11-12,14-16H,4,6-7,9-10,13H2,1-3,5H3/b14-12+,17-8-,19-11+,20-15+ |
| InChIKey | TZYVOXDJSUJBRO-OORTZSOMSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|