About (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one
(3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one (PubChem CID 143365707) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one.
Molecular Properties
| Compound Name | (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one |
| PubChem CID | 143365707 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one |
| SMILES | C[C@@]12CCOC1OCC2=O |
| InChI | InChI=1S/C7H10O3/c1-7-2-3-9-6(7)10-4-5(7)8/h6H,2-4H2,1H3/t6?,7-/m0/s1 |
| InChIKey | JZALZASQBIOPEZ-MLWJPKLSSA-N |
| XLogP | 0.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one?
The IUPAC name of (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one (CID 143365707) is (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one.
What is the SMILES notation for (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one?
The canonical SMILES for (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one is C[C@@]12CCOC1OCC2=O.
What is the InChIKey of (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one?
The InChIKey is JZALZASQBIOPEZ-MLWJPKLSSA-N. The full InChI is InChI=1S/C7H10O3/c1-7-2-3-9-6(7)10-4-5(7)8/h6H,2-4H2,1H3/t6?,7-/m0/s1.
What are the key properties of (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one?
(3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one has a molecular weight of 142.15 g/mol, XLogP of 0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3aR)-3a-methyl-3,6a-dihydro-2H-furo[2,3-b]furan-4-one is sourced from PubChem (CID 143365707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).