About 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol
6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol (PubChem CID 14336607) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol.
Molecular Properties
| Compound Name | 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol |
| PubChem CID | 14336607 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol |
| SMILES | C=C(CCC(O)C(C)(C)O)C1CCC(C)(O)C1C |
| InChI | InChI=1S/C15H28O3/c1-10(6-7-13(16)14(3,4)17)12-8-9-15(5,18)11(12)2/h11-13,16-18H,1,6-9H2,2-5H3 |
| InChIKey | KSLTUCODDJJNPT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol?
The IUPAC name of 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol (CID 14336607) is 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol.
What is the SMILES notation for 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol?
The canonical SMILES for 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol is C=C(CCC(O)C(C)(C)O)C1CCC(C)(O)C1C.
What is the InChIKey of 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol?
The InChIKey is KSLTUCODDJJNPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-10(6-7-13(16)14(3,4)17)12-8-9-15(5,18)11(12)2/h11-13,16-18H,1,6-9H2,2-5H3.
What are the key properties of 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol?
6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol has a molecular weight of 256.39 g/mol, XLogP of 2.25, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-hydroxy-2,3-dimethylcyclopentyl)-2-methylhept-6-ene-2,3-diol is sourced from PubChem (CID 14336607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).