C5H8N2S2 — CID 143366581
1,4-diazepane-2,7-dithione (PubChem CID 143366581) has the molecular formula C5H8N2S2 and a molecular weight of 160.27 g/mol. Its IUPAC name is 1,4-diazepane-2,7-dithione.
| Compound Name | 1,4-diazepane-2,7-dithione |
|---|---|
| PubChem CID | 143366581 |
| Molecular Formula | C5H8N2S2 |
| Molecular Weight | 160.27 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 1,4-diazepane-2,7-dithione |
| SMILES | S=C1CCNCC(=S)N1 |
| InChI | InChI=1S/C5H8N2S2/c8-4-1-2-6-3-5(9)7-4/h6H,1-3H2,(H,7,8,9) |
| InChIKey | GHXKARYUFGXMMO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|