C21H27ClN4O3 — CID 143367043
N-[1-[2-(tert-butylamino)-2-oxoethyl]-2-(3-methylphenyl)-6-oxopyrimidin-5-yl]-4-chlorobutanamide (PubChem CID 143367043) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is N-[1-[2-(tert-butylamino)-2-oxoethyl]-2-(3-methylphenyl)-6-oxopyrimidin-5-yl]-4-chlorobutanamide.
| Compound Name | N-[1-[2-(tert-butylamino)-2-oxoethyl]-2-(3-methylphenyl)-6-oxopyrimidin-5-yl]-4-chlorobutanamide |
|---|---|
| PubChem CID | 143367043 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[1-[2-(tert-butylamino)-2-oxoethyl]-2-(3-methylphenyl)-6-oxopyrimidin-5-yl]-4-chlorobutanamide |
| SMILES | Cc1cccc(-c2ncc(NC(=O)CCCCl)c(=O)n2CC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C21H27ClN4O3/c1-14-7-5-8-15(11-14)19-23-12-16(24-17(27)9-6-10-22)20(29)26(19)13-18(28)25-21(2,3)4/h5,7-8,11-12H,6,9-10,13H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | GQKHXULSYWDZPU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|