About ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine
ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine (PubChem CID 143367533) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine.
Molecular Properties
| Compound Name | ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine |
| PubChem CID | 143367533 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine |
| SMILES | CCO.Cc1ccccc1OC1c2ccccc2CC1CN |
| InChI | InChI=1S/C17H19NO.C2H6O/c1-12-6-2-5-9-16(12)19-17-14(11-18)10-13-7-3-4-8-15(13)17;1-2-3/h2-9,14,17H,10-11,18H2,1H3;3H,2H2,1H3 |
| InChIKey | FGOZGIJBFCMDIL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine?
The IUPAC name of ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine (CID 143367533) is ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine.
What is the SMILES notation for ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine?
The canonical SMILES for ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine is CCO.Cc1ccccc1OC1c2ccccc2CC1CN.
What is the InChIKey of ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine?
The InChIKey is FGOZGIJBFCMDIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO.C2H6O/c1-12-6-2-5-9-16(12)19-17-14(11-18)10-13-7-3-4-8-15(13)17;1-2-3/h2-9,14,17H,10-11,18H2,1H3;3H,2H2,1H3.
What are the key properties of ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine?
ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine has a molecular weight of 299.41 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;[1-(2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]methanamine is sourced from PubChem (CID 143367533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).