C19H25FO — CID 143367929
(1E,6Z)-2-fluoro-5,7-dimethyl-3-[(2E)-4-methylocta-2,4,7-trien-3-yl]oxycycloocta-1,3,6-triene (PubChem CID 143367929) has the molecular formula C19H25FO and a molecular weight of 288.41 g/mol. Its IUPAC name is (1E,6Z)-2-fluoro-5,7-dimethyl-3-[(2E)-4-methylocta-2,4,7-trien-3-yl]oxycycloocta-1,3,6-triene.
| Compound Name | (1E,6Z)-2-fluoro-5,7-dimethyl-3-[(2E)-4-methylocta-2,4,7-trien-3-yl]oxycycloocta-1,3,6-triene |
|---|---|
| PubChem CID | 143367929 |
| Molecular Formula | C19H25FO |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (1E,6Z)-2-fluoro-5,7-dimethyl-3-[(2E)-4-methylocta-2,4,7-trien-3-yl]oxycycloocta-1,3,6-triene |
| SMILES | C=CCC=C(C)/C(=C\C)OC1=CC(C)/C=C(/C)C/C=C\1F |
| InChI | InChI=1S/C19H25FO/c1-6-8-9-16(5)18(7-2)21-19-13-15(4)12-14(3)10-11-17(19)20/h6-7,9,11-13,15H,1,8,10H2,2-5H3/b14-12-,16-9?,17-11+,18-7+,19-13? |
| InChIKey | UTRVZQUJQXXJSH-UJJYJOIESA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|