About N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine
N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine (PubChem CID 143368043) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine.
Analyze N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine?
The IUPAC name of N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine (CID 143368043) is N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine.
What is the SMILES notation for N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine?
The canonical SMILES for N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine is CCN(C(C)C)C1CC(C)CC1C.
What is the InChIKey of N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine?
The InChIKey is YAZFIEFOSFLAON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N/c1-6-13(9(2)3)12-8-10(4)7-11(12)5/h9-12H,6-8H2,1-5H3.
What are the key properties of N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine?
N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine has a molecular weight of 183.34 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,4-dimethyl-N-propan-2-ylcyclopentan-1-amine is sourced from PubChem (CID 143368043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).