C12H11ClF3NO2S — CID 143368115
6-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalene-2-sulfinyl chloride (PubChem CID 143368115) has the molecular formula C12H11ClF3NO2S and a molecular weight of 325.74 g/mol. Its IUPAC name is 6-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalene-2-sulfinyl chloride.
| Compound Name | 6-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalene-2-sulfinyl chloride |
|---|---|
| PubChem CID | 143368115 |
| Molecular Formula | C12H11ClF3NO2S |
| Molecular Weight | 325.74 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 6-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalene-2-sulfinyl chloride |
| SMILES | O=C(NC1CCc2cc(S(=O)Cl)ccc2C1)C(F)(F)F |
| InChI | InChI=1S/C12H11ClF3NO2S/c13-20(19)10-4-2-7-5-9(3-1-8(7)6-10)17-11(18)12(14,15)16/h2,4,6,9H,1,3,5H2,(H,17,18) |
| InChIKey | NYLXUBFUFKXDMY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |