C9H15N5O — CID 143368314
(2R)-1-[[6-amino-5-(methylideneamino)pyrimidin-4-yl]-methylamino]propan-2-ol (PubChem CID 143368314) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is (2R)-1-[[6-amino-5-(methylideneamino)pyrimidin-4-yl]-methylamino]propan-2-ol.
| Compound Name | (2R)-1-[[6-amino-5-(methylideneamino)pyrimidin-4-yl]-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 143368314 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | (2R)-1-[[6-amino-5-(methylideneamino)pyrimidin-4-yl]-methylamino]propan-2-ol |
| SMILES | C=Nc1c(N)ncnc1N(C)C[C@@H](C)O |
| InChI | InChI=1S/C9H15N5O/c1-6(15)4-14(3)9-7(11-2)8(10)12-5-13-9/h5-6,15H,2,4H2,1,3H3,(H2,10,12,13)/t6-/m1/s1 |
| InChIKey | WKQDJNRBUPZDOO-ZCFIWIBFSA-N |
| XLogP | 0.21 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|