C14H31NO — CID 143368929
ethane;2-ethyl-5-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine (PubChem CID 143368929) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is ethane;2-ethyl-5-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine.
| Compound Name | ethane;2-ethyl-5-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 143368929 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | ethane;2-ethyl-5-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
| SMILES | CC.CC.CCC1CC2CN(C)CCC2O1 |
| InChI | InChI=1S/C10H19NO.2C2H6/c1-3-9-6-8-7-11(2)5-4-10(8)12-9;2*1-2/h8-10H,3-7H2,1-2H3;2*1-2H3 |
| InChIKey | UPGQMPLPLQFPAB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |