C20H38 — CID 143369084
[(E)-4,6,9,11-tetramethyltridec-2-enyl]cyclopropane (PubChem CID 143369084) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is [(E)-4,6,9,11-tetramethyltridec-2-enyl]cyclopropane.
| Compound Name | [(E)-4,6,9,11-tetramethyltridec-2-enyl]cyclopropane |
|---|---|
| PubChem CID | 143369084 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | [(E)-4,6,9,11-tetramethyltridec-2-enyl]cyclopropane |
| SMILES | CCC(C)CC(C)CCC(C)CC(C)/C=C/CC1CC1 |
| InChI | InChI=1S/C20H38/c1-6-16(2)14-18(4)10-11-19(5)15-17(3)8-7-9-20-12-13-20/h7-8,16-20H,6,9-15H2,1-5H3/b8-7+ |
| InChIKey | WLDACKBGURDFNI-BQYQJAHWSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|