About 3-amino-2-formyl-N,6-dimethylbenzamide
3-amino-2-formyl-N,6-dimethylbenzamide (PubChem CID 143370207) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-amino-2-formyl-N,6-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-amino-2-formyl-N,6-dimethylbenzamide |
| PubChem CID | 143370207 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3-amino-2-formyl-N,6-dimethylbenzamide |
| SMILES | CNC(=O)c1c(C)ccc(N)c1C=O |
| InChI | InChI=1S/C10H12N2O2/c1-6-3-4-8(11)7(5-13)9(6)10(14)12-2/h3-5H,11H2,1-2H3,(H,12,14) |
| InChIKey | SRCZFCOPCPIDSO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-formyl-N,6-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-formyl-N,6-dimethylbenzamide?
The IUPAC name of 3-amino-2-formyl-N,6-dimethylbenzamide (CID 143370207) is 3-amino-2-formyl-N,6-dimethylbenzamide.
What is the SMILES notation for 3-amino-2-formyl-N,6-dimethylbenzamide?
The canonical SMILES for 3-amino-2-formyl-N,6-dimethylbenzamide is CNC(=O)c1c(C)ccc(N)c1C=O.
What is the InChIKey of 3-amino-2-formyl-N,6-dimethylbenzamide?
The InChIKey is SRCZFCOPCPIDSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-6-3-4-8(11)7(5-13)9(6)10(14)12-2/h3-5H,11H2,1-2H3,(H,12,14).
What are the key properties of 3-amino-2-formyl-N,6-dimethylbenzamide?
3-amino-2-formyl-N,6-dimethylbenzamide has a molecular weight of 192.22 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-formyl-N,6-dimethylbenzamide is sourced from PubChem (CID 143370207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).