C18H21F3N6 — CID 143370547
(NZ)-3-(1H-indazol-5-ylamino)-N-prop-2-enylidene-N'-(2,2,2-trifluoroethyl)piperidine-1-carboximidamide (PubChem CID 143370547) has the molecular formula C18H21F3N6 and a molecular weight of 378.40 g/mol. Its IUPAC name is (NZ)-3-(1H-indazol-5-ylamino)-N-prop-2-enylidene-N'-(2,2,2-trifluoroethyl)piperidine-1-carboximidamide.
| Compound Name | (NZ)-3-(1H-indazol-5-ylamino)-N-prop-2-enylidene-N'-(2,2,2-trifluoroethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 143370547 |
| Molecular Formula | C18H21F3N6 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (NZ)-3-(1H-indazol-5-ylamino)-N-prop-2-enylidene-N'-(2,2,2-trifluoroethyl)piperidine-1-carboximidamide |
| SMILES | C=C/C=N\C(=N/CC(F)(F)F)N1CCCC(Nc2ccc3[nH]ncc3c2)C1 |
| InChI | InChI=1S/C18H21F3N6/c1-2-7-22-17(23-12-18(19,20)21)27-8-3-4-15(11-27)25-14-5-6-16-13(9-14)10-24-26-16/h2,5-7,9-10,15,25H,1,3-4,8,11-12H2,(H,24,26)/b22-7-,23-17+ |
| InChIKey | XDIRRKJECRCYQX-RQMWHWEXSA-N |
| XLogP | 3.61 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|