About [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+)
[2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+) (PubChem CID 143370731) has the molecular formula C13H16NORb
and a molecular weight of 287.75 g/mol. Its IUPAC name is [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+).
Molecular Properties
| Compound Name | [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+) |
| PubChem CID | 143370731 |
| Molecular Formula | C13H16NORb |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+) |
| SMILES | Cc1ccc(C2(CC([NH-])=O)CCC2)cc1.[Rb+] |
| InChI | InChI=1S/C13H17NO.Rb/c1-10-3-5-11(6-4-10)13(7-2-8-13)9-12(14)15;/h3-6H,2,7-9H2,1H3,(H2,14,15);/q;+1/p-1 |
| InChIKey | SETINBDPLMWECS-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+)?
The IUPAC name of [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+) (CID 143370731) is [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+).
What is the SMILES notation for [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+)?
The canonical SMILES for [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+) is Cc1ccc(C2(CC([NH-])=O)CCC2)cc1.[Rb+].
What is the InChIKey of [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+)?
The InChIKey is SETINBDPLMWECS-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H17NO.Rb/c1-10-3-5-11(6-4-10)13(7-2-8-13)9-12(14)15;/h3-6H,2,7-9H2,1H3,(H2,14,15);/q;+1/p-1.
What are the key properties of [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+)?
[2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+) has a molecular weight of 287.75 g/mol, XLogP of 0.39, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(4-methylphenyl)cyclobutyl]acetyl]azanide;rubidium(1+) is sourced from PubChem (CID 143370731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).