C21H27N5O3S2 — CID 143370838
ethane;methanethiol;5-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]pyridine-3-carboxylic acid (PubChem CID 143370838) has the molecular formula C21H27N5O3S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is ethane;methanethiol;5-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]pyridine-3-carboxylic acid.
| Compound Name | ethane;methanethiol;5-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 143370838 |
| Molecular Formula | C21H27N5O3S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | ethane;methanethiol;5-[2-[(4-morpholin-4-yl-2-pyridinyl)amino]-1,3-thiazol-5-yl]pyridine-3-carboxylic acid |
| SMILES | CC.CS.O=C(O)c1cncc(-c2cnc(Nc3cc(N4CCOCC4)ccn3)s2)c1 |
| InChI | InChI=1S/C18H17N5O3S.C2H6.CH4S/c24-17(25)13-7-12(9-19-10-13)15-11-21-18(27-15)22-16-8-14(1-2-20-16)23-3-5-26-6-4-23;2*1-2/h1-2,7-11H,3-6H2,(H,24,25)(H,20,21,22);1-2H3;2H,1H3 |
| InChIKey | YHQPCCUYSYQWQT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|