C34H33N9 — CID 143370985
[3-phenyl-2-[4-[[4-(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]methyl]phenyl]-5H-pyrido[2,3-d]azepin-6-yl]hydrazine (PubChem CID 143370985) has the molecular formula C34H33N9 and a molecular weight of 567.70 g/mol. Its IUPAC name is [3-phenyl-2-[4-[[4-(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]methyl]phenyl]-5H-pyrido[2,3-d]azepin-6-yl]hydrazine.
| Compound Name | [3-phenyl-2-[4-[[4-(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]methyl]phenyl]-5H-pyrido[2,3-d]azepin-6-yl]hydrazine |
|---|---|
| PubChem CID | 143370985 |
| Molecular Formula | C34H33N9 |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | [3-phenyl-2-[4-[[4-(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]methyl]phenyl]-5H-pyrido[2,3-d]azepin-6-yl]hydrazine |
| SMILES | NNC1=NC=Cc2nc(-c3ccc(CN4CCC(c5nc(-c6ccccn6)n[nH]5)CC4)cc3)c(-c3ccccc3)cc2C1 |
| InChI | InChI=1S/C34H33N9/c35-40-31-21-27-20-28(24-6-2-1-3-7-24)32(38-29(27)13-17-37-31)25-11-9-23(10-12-25)22-43-18-14-26(15-19-43)33-39-34(42-41-33)30-8-4-5-16-36-30/h1-13,16-17,20,26H,14-15,18-19,21-22,35H2,(H,37,40)(H,39,41,42) |
| InChIKey | BSEWBWWCWBPFIH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|