C23H32N6O2 — CID 143371220
2-[1-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]piperidin-4-yl]-N-[(4-propan-2-ylphenyl)methyl]acetamide (PubChem CID 143371220) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[1-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]piperidin-4-yl]-N-[(4-propan-2-ylphenyl)methyl]acetamide.
| Compound Name | 2-[1-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]piperidin-4-yl]-N-[(4-propan-2-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 143371220 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-[1-[6-amino-5-[(E)-methoxyiminomethyl]pyrimidin-4-yl]piperidin-4-yl]-N-[(4-propan-2-ylphenyl)methyl]acetamide |
| SMILES | CO/N=C/c1c(N)ncnc1N1CCC(CC(=O)NCc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H32N6O2/c1-16(2)19-6-4-18(5-7-19)13-25-21(30)12-17-8-10-29(11-9-17)23-20(14-28-31-3)22(24)26-15-27-23/h4-7,14-17H,8-13H2,1-3H3,(H,25,30)(H2,24,26,27)/b28-14+ |
| InChIKey | GEQOKOBIQPKAPJ-CCVNUDIWSA-N |
| XLogP | 3.09 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|