C19H26N4O2 — CID 143371287
tert-butyl N-[1-(7-methylquinazolin-4-yl)piperidin-4-yl]carbamate (PubChem CID 143371287) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl N-[1-(7-methylquinazolin-4-yl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(7-methylquinazolin-4-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 143371287 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | tert-butyl N-[1-(7-methylquinazolin-4-yl)piperidin-4-yl]carbamate |
| SMILES | Cc1ccc2c(N3CCC(NC(=O)OC(C)(C)C)CC3)ncnc2c1 |
| InChI | InChI=1S/C19H26N4O2/c1-13-5-6-15-16(11-13)20-12-21-17(15)23-9-7-14(8-10-23)22-18(24)25-19(2,3)4/h5-6,11-12,14H,7-10H2,1-4H3,(H,22,24) |
| InChIKey | MJVBLGDDLILVNR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |