C12H18FN — CID 143371488
(E)-1-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-2-methylbut-2-en-1-amine (PubChem CID 143371488) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is (E)-1-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-2-methylbut-2-en-1-amine.
| Compound Name | (E)-1-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-2-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 143371488 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (E)-1-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)-2-methylbut-2-en-1-amine |
| SMILES | C/C=C(\C)C(N)C1C=CC(F)=CC1C |
| InChI | InChI=1S/C12H18FN/c1-4-8(2)12(14)11-6-5-10(13)7-9(11)3/h4-7,9,11-12H,14H2,1-3H3/b8-4+ |
| InChIKey | FKYYUZPDTWYPCX-XBXARRHUSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|