C16H25NO2 — CID 143371791
(E,2R)-5-(6-ethenylcyclohexa-2,4-dien-1-yl)-N,4-dimethylpent-4-en-2-amine;formic acid (PubChem CID 143371791) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (E,2R)-5-(6-ethenylcyclohexa-2,4-dien-1-yl)-N,4-dimethylpent-4-en-2-amine;formic acid.
| Compound Name | (E,2R)-5-(6-ethenylcyclohexa-2,4-dien-1-yl)-N,4-dimethylpent-4-en-2-amine;formic acid |
|---|---|
| PubChem CID | 143371791 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (E,2R)-5-(6-ethenylcyclohexa-2,4-dien-1-yl)-N,4-dimethylpent-4-en-2-amine;formic acid |
| SMILES | C=CC1C=CC=CC1/C=C(\C)C[C@@H](C)NC.O=CO |
| InChI | InChI=1S/C15H23N.CH2O2/c1-5-14-8-6-7-9-15(14)11-12(2)10-13(3)16-4;2-1-3/h5-9,11,13-16H,1,10H2,2-4H3;1H,(H,2,3)/b12-11+;/t13-,14?,15?;/m1./s1 |
| InChIKey | YIZYODANTZPRHV-LPZIQWBCSA-N |
| XLogP | 3.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|