C27H23F3N2O2 — CID 143372109
1-(2,3-dihydro-1H-inden-5-yloxy)-3,3-difluoro-2-[1-(4-fluorophenyl)indazol-5-yl]pent-4-en-2-ol (PubChem CID 143372109) has the molecular formula C27H23F3N2O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yloxy)-3,3-difluoro-2-[1-(4-fluorophenyl)indazol-5-yl]pent-4-en-2-ol.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yloxy)-3,3-difluoro-2-[1-(4-fluorophenyl)indazol-5-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 143372109 |
| Molecular Formula | C27H23F3N2O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yloxy)-3,3-difluoro-2-[1-(4-fluorophenyl)indazol-5-yl]pent-4-en-2-ol |
| SMILES | C=CC(F)(F)C(O)(COc1ccc2c(c1)CCC2)c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H23F3N2O2/c1-2-27(29,30)26(33,17-34-24-12-6-18-4-3-5-19(18)15-24)21-7-13-25-20(14-21)16-31-32(25)23-10-8-22(28)9-11-23/h2,6-16,33H,1,3-5,17H2 |
| InChIKey | UVLGTXNRQYLRHS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|