C24H25F4N3O — CID 143372428
fluoroform;1-[1-(4-fluorophenyl)indazol-5-yl]-2-[[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-methylamino]ethanol (PubChem CID 143372428) has the molecular formula C24H25F4N3O and a molecular weight of 447.48 g/mol. Its IUPAC name is fluoroform;1-[1-(4-fluorophenyl)indazol-5-yl]-2-[[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-methylamino]ethanol.
| Compound Name | fluoroform;1-[1-(4-fluorophenyl)indazol-5-yl]-2-[[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-methylamino]ethanol |
|---|---|
| PubChem CID | 143372428 |
| Molecular Formula | C24H25F4N3O |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | fluoroform;1-[1-(4-fluorophenyl)indazol-5-yl]-2-[[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-methylamino]ethanol |
| SMILES | C/C=C\C=C/C=C/N(C)CC(O)c1ccc2c(cnn2-c2ccc(F)cc2)c1.FC(F)F |
| InChI | InChI=1S/C23H24FN3O.CHF3/c1-3-4-5-6-7-14-26(2)17-23(28)18-8-13-22-19(15-18)16-25-27(22)21-11-9-20(24)10-12-21;2-1(3)4/h3-16,23,28H,17H2,1-2H3;1H/b4-3-,6-5-,14-7+; |
| InChIKey | RDVJQSORZZXVFW-NLGZJMDBSA-N |
| XLogP | 5.95 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|